|
Input product name or CAS |
3,5-Dibromobenzonitrile |
4-tritylaniline |
benzyl anthranilate |
2-hydroxy-4¡¯-iodoacetophenone |
N-(2-nitrophenyl)phosphoric triamide |
2,3-diaminobenzoic acid |
2-amino-3-nitrobenzoic acid |
4-amino-5-chloro-2-methoxybenzoic acid |
4-amino-5-bromo-2-methoxybenzoic acid |
4-amino-5-chloro-2-ethoxybenzoic acid |
Potassium 4-nitrophenyl sulfate |
2,4,5-trichlorobenzoic acid |
4-bromo-2-nitrophenol |
2-amino-4-bromophenol |
2-amino-3-(trifluoromethoxy)benzoic acid |
4-nitrothiophenol |
4-aminothiophenol |
Methyl 3,5-dimethoxybenzoate |
4-Phenyl-1H-1,2,3-triazole |
2-(trimethylsilyl)thiazole |
6-O-Benzylguanine |
4-(2-Thienyl)butyric acid |
3-BROMO-TETRAHYDRO-PYRAN |
Ethyl 3-oxo-3-(furan-3-yl)propanoate |
6-Nitroquinazolin-4(3H)-one |
Thiophene-3,4-diol |
4-(2-Chloroethyl)-1H-imidazole |
3-bromo-4-chloropyridine |
3-bromopyridin-4-amine |
3-bromo-4-nitropyridine N-oxide |
ethyl nicotinate |
2-bromo-4-nitropyridine N-oxide |
2-bromopyridin-4-amine |
2-chloro-4-nitropyridine |
2-chloro-4-nitropyridine N-oxide |
2-chloropyridin-4-amine |
3-methoxy-2-nitropyridine |
5-AMINO-2-METHOXYPYRIDINE |
2-Amino-3-methoxypyridine |
2-Methoxypyridin-3-amine |
5-Methoxynicotinic acid |
4-Chloropyridine-2,6-dicarboxylic acid |
4-Hydroxypyridine-2,6-dicarboxylic acid |
2-Bromopyridine-3-carbaldehyde |
1,5-Dimethyl-1H-pyrazole |
1H-pyrazol-3-amine |
3-Nitro-1H-pyrazole |
4-Nitro-1H-pyrazole |
1H-Pyrazole-4-carbonitrile |
Oxazol-2-amine |
1H-Imidazole-2-carboxylic acid |
4-Nitroisoquinoline |
N-Boc-3-Ethylpiperazine |
2-Ethylpiperazine |
4-Cyanopiperidine |
N-1-Boc-2-ethyl-piperazine |
tert-butyl pyridin-4-ylcarbamate |
5-Methyl Isoxazole-4-Carboxylic Acid |
3(2H)-Pyridazinone |
1-(2-Thienyl)ethylamine |
1-(thiophen-2-yl)propan-2-amine |
1-Boc-2-Methylpiperazine |
(S)-1-N-Boc-2-methylpiperazine |
N,N¡¯-Octamethylenebis(dichloroacetamide) |
(E)-1-bromo-2-trimethylsilylethene |
N-Methyl-N-n-dodecyl-N,N-di(hydroxyethyl)ammonium bromide |
Bis(2-hydroxyethyl)methyltetradecylammonium bromide |
Bis(2-hydroxyethyl)hexadecyl(methyl)ammonium bromide |
Bis(2-hydroxyethyl)methyloctadecylammonium bromide |
Dess-Martin periodinane |
tert-butyl 2-aminoethylcarbamate |
5-Bromopentanoic acid |
Methyl 5-bromovalerate |
Ethyl 5-bromovalerate |
6-Bromocaproic acid |
Methyl 6-bromohexanoate |
4-Bromobutyric acid |
Methyl 2,4-dibromobutyrate |
Ethyl 4-bromoacetoacetate |
1,4-Dibromo-2,3-butanedione |
4-Bromobenzoyl chloride |
3-Chloro-6-iodopyridazine |
2-Iodoxybenzoic acid |
2-Methoxy-3-nitropyridine |
Diethyl isoamylmalonate |
1-(Phenyl) 2-nitroethane |
Chelidonic acid |
5-Iodo-2-furancarboxaldehyde |
Alogliptin Benzoate |
Rivaroxaban |
Ethyl isopropyl sulfone |
3-(4-Methoxyphenyl)propionaldehyde |
Ferritin from horse spleen |
2,4,6-Trichloro-5-pyrimidinecarboxaldehyde |
Ethyl 4-bromobenzoylformate |
2-Chloroquinoline-4-carboxylic acid |
4,4¡¯-Azodianiline |
Dibenzothiophene-5-oxide |
3,7-Diaminodibenzothiophene |
3,7-Dibromodibenzo[b,d]thiophene 5,5-dioxide |
3,7-Dibromodibenzothiophene |
S-BOC-BMI |
R-BOC-BMI |
Chloromethyl benzoate |
(+)-Abscisic acid |
|
3-Nitro-1H-pyrazole-5-carboxylic acid |
(4-Chloro-phenyl)-oxo-acetonitrile |
2-Bromo-N,N-dimethyl-ethylaminhydrobromide |
1,3-Dimethoxy-1,3-dimethylurea |
2-Bromodiethylacetic Acid |
1,2-Bis(Phenylamino)ethane |
N-Methoxy-N-methyl-1H-imidazole-1-carboxamide |
4-chlorocarbonyl-piperazine-1-carboxylic acid tert-butyl ester |
4-(2-Aminoethyl)pyridine |
2-Ketoadipic acid |
Ethyl 3-bromobutyrate |
|
|
Nanjing Qite Chemical Technology Co.,Ltd. Is a technology-driven enterprise¡£It is a professional manufacturer of various fine chemicals, including pharmaceutical intermediates, agrochemical intermediates, organic ptoelectrical materials. We devotes to research and development, production and sales of various chemicals and have a profound experience in organic synthesis and full independence in new products development. With advanced equipment and strict management system, we are convinced that we can provoide comprehensive service from Lab-scale product development, custom manufacuring to mass production in the plant. |
Relying on the superiority of the Nanjing college of chemical technology ,the company lies in Zhongshan science and Technology Park which is the Provincial Branch Park of JiangSu. Key members of the company form by the fine chemicals who have engaged in for many years by research and development in Colleges and universities and technical personnels who have chemical production enterprises frontline experience in the production of enterprises
"Professional, Efficient and Excellent" is always our business philosophy and we sincerely hope to establish business relations with clients home and abroad and create a splendid future with common efforts together. |
|
|
|